Compound search：Set keywords and then click SEARCH.
Please contact us by using the Inquiry Form
. We will ask for more details by e-mail, so just a brief description is sufficient. You can also contact us from the page that appears by clicking on the structural formula.
| SCHEM No. | Structure | Compound Name | Price (JPY) | Purity | Stock(mg) |
|---|---|---|---|---|---|
| 06356 |  | Cyclic(-S-PEG10-) | 80,700/0.1mg | >95% | 0 |
| 06355 |  | Cyclic(-S-PEG4-S-PEG6-) | 80,700/0.1mg | >95% | 0 |
| 06375 |  | Cyclic(-S-PEG9-) | 80,700/0.1mg | >95% | 3.5 |
| 06349 |  | Cyclic(-S-PEG5-S-PEG3-) | 80,700/0.1mg | >95% | 0 |
| 00369 |  | N3-PEG8-COOH | 73,600/2.5mg | >95% | 0 |
| 06350 |  | Cyclic(-S-PEG7-S-PEG1-) | 80,700/0.1mg | >95% | 0 |
| 06377 |  | Cyclic(-S-PEG5-) | 80,700/0.1mg | >95% | 0 |
| 05343 |  | DMT-PEG5-S-PEG4-ODMT | 64,600/500mg | >80% | 2,114.2 |
| 04743 |  | DMT-PEG5-S-Et-OH | 72,000/50mg | >90% | 300.6 |
| 05344 |  | DMT-PEG4-S-Et-OAc | 64,600/100mg | >80% | 426.3 |
| 03828 |  | Trt-PEG3-S-Et-OH | 74,600/25mg | >90% | 408.1 |
| 06351 |  | Cyclic(-S-PEG3-S-PEG1-)2 | 80,700/0.1mg | >95% | 0 |
| 06346 |  | Cyclic(-S-PEG3-S-CH2-O-CH2-)2 | 80,700/0.1mg | >95% | 0 |
| 02195 |  | TrtNH-PEG1-S-Et-OH | 65,600/25mg | >90% | 136.0 |
| 06145 |  | 5-ethylsulfanyl-1-phenyl-tetrazole | 64,600/50mg | >95% | 300.0 |
| 04891 |  | 2-S-Cysteinyldopa | 81,600/0.1mg | >95% | 25.0 |
| 02909 |  | GSH-S-Bimane | 63,300/0.9mg | >95% | 30.3 |
