Derived from both terminal tosylates to thiols in a two-step process.
Due to stability problems (easily oxidised in air) and a strong odour depending on the reagents used, the synthesis of thiols requires a unique technique.
Methods for the synthesis and purification of double-ended thiol-PEGs of various lengths have been established after much struggle.
SCHEM No. | Structure | Compound Name | Price (JPY) | Purity | Stock(mg) |
---|---|---|---|---|---|
06363 | ![]() | SH-PEG12-SH | 75,800/2.5mg | >90% | 0 |
06362 | ![]() | SH-PEG11-SH | 72,300/0.2mg | >90% | 0 |
06361 | ![]() | SH-PEG10-SH | 69,200/0.4mg | >90% | 0 |
01724 | ![]() | SH-PEG9-SH | 75,800/2.5mg | >90% | 44.3 |
06360 | ![]() | SH-PEG8-SH | 89,200/2.5mg | >90% | 0 |
06359 | ![]() | SH-PEG7-SH | 80,900/0.7mg | >90% | 0 |
01794 | ![]() | SH-PEG6-SH | 64,800/0.7mg | >90% | 0 |
06357 | ![]() | SH-PEG5-SH | 64,800/0.7mg | >90% | 0 |
04712 | ![]() | SH-PEG4-SH | inquire | >90% | 60.0 |
06358 | ![]() | SH-PEG3-SH | inquire | >90% | 1.3 |
Can be utilised as a covalent linker with Michael addition via SH.DISULFIDE bonds can be cleaved with mild reducing agents such as DTT.
SCHEM No. | Structure | Compound Name | Price (JPY) | Purity | Stock(mg) |
---|---|---|---|---|---|
06340 | ![]() | SH-PEG4-SS-PEG4-SH | 84,900/0.7mg | >90% | 34.0 |
06341 | ![]() | SH-PEG3-SS-PEG3-SH | 84,900/0.7mg | >90% | 0 |
SCHEM No. | Structure | Compound Name | Price (JPY) | Purity | Stock(mg) |
---|---|---|---|---|---|
06354 | ![]() | Cyclic(-S-PEG12-S-) | 72,300/0.1mg | >95% | 0 |
06384 | ![]() | Cyclic(-S-PEG4-S-)9 | 149,900/0.1mg | >95% | 0.1 |
06383 | ![]() | Cyclic(-S-PEG4-S-)8 | 149,900/0.1mg | >90% | 0.1 |
06382 | ![]() | Cyclic(-S-PEG4-S-)7 | 149,900/0.1mg | >90% | 0.1 |
06381 | ![]() | Cyclic(-S-PEG4-S-)6 | 149,900/0.1mg | >90% | 0.1 |
06380 | ![]() | Cyclic(-S-PEG4-S-)5 | 149,900/0.1mg | >90% | 0.1 |
06379 | ![]() | Cyclic(-S-PEG4-S-)4 | 149,900/0.1mg | >90% | 0.1 |
06378 | ![]() | Cyclic(-S-PEG4-S-)3 | 149,900/0.1mg | >90% | 0.1 |
06353 | ![]() | Cyclic(-S-PEG4-S-)4 | 84,600/0.1mg | >95% | 0 |
06352 | ![]() | Cyclic(-S-PEG4-S-)3 | 84,600/0.1mg | >95% | 0 |
06343 | ![]() | Cyclic(-S-PEG4-S-)2 | 149,900/0.1mg | >95% | 0.1 |
06342 | ![]() | Cyclic(-S-PEG3-S-)2 | 85,700/0.1mg | >95% | 0 |
SCHEM No. | Structure | Compound Name | Price (JPY) | Purity | Stock(mg) |
---|---|---|---|---|---|
06356 | ![]() | Cyclic(-S-PEG10-) | 85,700/0.1mg | >95% | 0 |
06355 | ![]() | Cyclic(-S-PEG4-S-PEG6-) | 85,700/0.1mg | >95% | 0 |
06375 | ![]() | Cyclic(-S-PEG9-) | 85,700/0.1mg | >95% | 3.5 |
06349 | ![]() | Cyclic(-S-PEG5-S-PEG3-) | 85,700/0.1mg | >95% | 0 |
06350 | ![]() | Cyclic(-S-PEG7-S-PEG1-) | 85,700/0.1mg | >95% | 0 |
06377 | ![]() | Cyclic(-S-PEG5-) | 85,700/0.1mg | >95% | 0 |
06351 | ![]() | Cyclic(-S-PEG3-S-PEG1-)2 | 85,700/0.1mg | >95% | 0 |
06346 | ![]() | Cyclic(-S-PEG3-S-CH2-O-CH2-)2 | 85,700/0.1mg | >95% | 0 |
N-containing crown ethers (aza-crown) have also been synthesised.
We have only synthesised one azacrown because the size of the market is unknown, but we have already established a synthetic method and many of the intermediates of each length are in stock, so if you contact us, we can synthesise an azacrown of the size you require within two weeks.
SCHEM No. | Structure | Compound Name | Price (JPY) | Purity | Stock(mg) |
---|---|---|---|---|---|
06451 | ![]() | Cyclic(-NH-PEG14-) | 98,000/0.1mg | >90% | 0 |
06452 | ![]() | Cyclic(-NH-PEG13-) | 85,700/0.1mg | >90% | 0 |
06507 | ![]() | Cyclic(-NH-PEG12-) | 85,700/0.1mg | >90% | 0 |
06506 | ![]() | Cyclic(-NH-PEG11-) | 85,700/0.1mg | >90% | 0 |
06457 | ![]() | Cyclic(-PEG4-N-)-CO-PEG11-COOH | 72,300/0.1mg | >95% | 13.3 |
06505 | ![]() | Cyclic(-NH-PEG10-) | 85,700/0.1mg | >90% | 0 |
06504 | ![]() | Cyclic(-NH-PEG9-) | 85,700/0.1mg | >90% | 0 |
06503 | ![]() | Cyclic(-NH-PEG8-) | 85,700/0.1mg | >90% | 0 |
06502 | ![]() | Cyclic(-NH-PEG7-) | 85,700/0.1mg | >90% | 0 |
06501 | ![]() | Cyclic(-NH-PEG6-) | 85,700/0.1mg | >90% | 0 |
06376 | ![]() | Cyclic(-NH-PEG5-) | 80,900/0.7mg | >90% | 6.0 |
06385 | ![]() | Cyclic(-NH-PEG4-) | inquire | >90% | 0 |
06388 | ![]() | Cyclic(-NH-PEG3-) | 101,800/0.1mg | >90% | 0 |
Click here for a list of crown ethers with branches without N.
Limited to what is technically possible, e.g. length of PEG chain, substitution to heteroatoms other than O, number of substitutions, etc., but feel free to ask anything!