Synthesis of double-ended SH polyethylene glycol.
We have established a method for the synthesis of PEG with double-ended SH (SH-PEGn-SH).
Derived from both terminal tosylates to thiols in a two-step process.
Due to stability problems (easily oxidised in air) and a strong odour depending on the reagents used, the synthesis of thiols requires a unique technique.
Methods for the synthesis and purification of double-ended thiol-PEGs of various lengths have been established after much struggle.
| SCHEM No. | Structure | Compound Name | Price (JPY) | Purity | Stock(mg) |
|---|---|---|---|---|---|
| 06363 |  | SH-PEG12-SH | 75,000/2.5mg | >90% | 0 |
| 06362 |  | SH-PEG11-SH | 71,500/0.2mg | >90% | 0 |
| 06361 |  | SH-PEG10-SH | 68,400/0.4mg | >90% | 0 |
| 01724 |  | SH-PEG9-SH | 75,000/2.5mg | >90% | 44.3 |
| 06360 |  | SH-PEG8-SH | 88,400/2.5mg | >90% | 0 |
| 06359 |  | SH-PEG7-SH | 80,100/0.7mg | >90% | 0 |
| 01794 |  | SH-PEG6-SH | 64,000/0.7mg | >90% | 0 |
| 06357 |  | SH-PEG5-SH | 64,000/0.7mg | >90% | 0 |
| 04712 |  | SH-PEG4-SH | inquire | >90% | 60.0 |
| 06358 |  | SH-PEG3-SH | inquire | >90% | 1.3 |
Can be derived from SH-PEGn-SH to the following. :dimer by disulfide bonding.
Can be utilised as a covalent linker with Michael addition via SH.DISULFIDE bonds can be cleaved with mild reducing agents such as DTT.
| SCHEM No. | Structure | Compound Name | Price (JPY) | Purity | Stock(mg) |
|---|---|---|---|---|---|
| 06340 |  | SH-PEG4-SS-PEG4-SH | 84,100/0.7mg | >90% | 34.0 |
| 06341 |  | SH-PEG3-SS-PEG3-SH | 84,100/0.7mg | >90% | 0 |
Oxidation of the SH-PEGn-SH structure forms cyclic disulphides.
| SCHEM No. | Structure | Compound Name | Price (JPY) | Purity | Stock(mg) |
|---|---|---|---|---|---|
| 06354 |  | Cyclic(-S-PEG12-S-) | 71,500/0.1mg | >95% | 0 |
| 06384 |  | Cyclic(-S-PEG4-S-)9 | 149,100/0.1mg | >95% | 0.1 |
| 06383 |  | Cyclic(-S-PEG4-S-)8 | 149,100/0.1mg | >90% | 0.1 |
| 06382 |  | Cyclic(-S-PEG4-S-)7 | 149,100/0.1mg | >90% | 0.1 |
| 06381 |  | Cyclic(-S-PEG4-S-)6 | 149,100/0.1mg | >90% | 0.1 |
| 06380 |  | Cyclic(-S-PEG4-S-)5 | 149,100/0.1mg | >90% | 0.1 |
| 06379 |  | Cyclic(-S-PEG4-S-)4 | 149,100/0.1mg | >90% | 0.1 |
| 06378 |  | Cyclic(-S-PEG4-S-)3 | 149,100/0.1mg | >90% | 0.1 |
| 06353 |  | Cyclic(-S-PEG4-S-)4 | 83,800/0.1mg | >95% | 0 |
| 06352 |  | Cyclic(-S-PEG4-S-)3 | 83,800/0.1mg | >95% | 0 |
| 06343 |  | Cyclic(-S-PEG4-S-)2 | 149,100/0.1mg | >95% | 0.1 |
| 06342 |  | Cyclic(-S-PEG3-S-)2 | 84,900/0.1mg | >95% | 0 |
Cyclic thioethers can be synthesised from SH-PEGn-OH.h5>
| SCHEM No. | Structure | Compound Name | Price (JPY) | Purity | Stock(mg) |
|---|---|---|---|---|---|
| 06356 |  | Cyclic(-S-PEG10-) | 84,900/0.1mg | >95% | 0 |
| 06355 |  | Cyclic(-S-PEG4-S-PEG6-) | 84,900/0.1mg | >95% | 0 |
| 06375 |  | Cyclic(-S-PEG9-) | 84,900/0.1mg | >95% | 3.5 |
| 06349 |  | Cyclic(-S-PEG5-S-PEG3-) | 84,900/0.1mg | >95% | 0 |
| 06350 |  | Cyclic(-S-PEG7-S-PEG1-) | 84,900/0.1mg | >95% | 0 |
| 06377 |  | Cyclic(-S-PEG5-) | 84,900/0.1mg | >95% | 0 |
| 06351 |  | Cyclic(-S-PEG3-S-PEG1-)2 | 84,900/0.1mg | >95% | 0 |
| 06346 |  | Cyclic(-S-PEG3-S-CH2-O-CH2-)2 | 84,900/0.1mg | >95% | 0 |
N-containing crown ethers (aza-crown) have also been synthesised.
Aza-crowns can be synthesised from NH2-PEGn-OH.
We have only synthesised one azacrown because the size of the market is unknown, but we have already established a synthetic method and many of the intermediates of each length are in stock, so if you contact us, we can synthesise an azacrown of the size you require within two weeks.
| SCHEM No. | Structure | Compound Name | Price (JPY) | Purity | Stock(mg) |
|---|---|---|---|---|---|
| 06451 |  | Cyclic(-NH-PEG14-) | 97,200/0.1mg | >90% | 0 |
| 06452 |  | Cyclic(-NH-PEG13-) | 84,900/0.1mg | >90% | 0 |
| 06507 |  | Cyclic(-NH-PEG12-) | 84,900/0.1mg | >90% | 0 |
| 06506 |  | Cyclic(-NH-PEG11-) | 84,900/0.1mg | >90% | 0 |
| 06457 |  | Cyclic(-PEG4-N-)-CO-PEG11-COOH | 71,500/0.1mg | >95% | 13.3 |
| 06505 |  | Cyclic(-NH-PEG10-) | 84,900/0.1mg | >90% | 0 |
| 06504 |  | Cyclic(-NH-PEG9-) | 84,900/0.1mg | >90% | 0 |
| 06503 |  | Cyclic(-NH-PEG8-) | 84,900/0.1mg | >90% | 0 |
| 06502 |  | Cyclic(-NH-PEG7-) | 84,900/0.1mg | >90% | 0 |
| 06501 |  | Cyclic(-NH-PEG6-) | 84,900/0.1mg | >90% | 0 |
| 06376 |  | Cyclic(-NH-PEG5-) | 80,100/0.7mg | >90% | 6.0 |
| 06385 |  | Cyclic(-NH-PEG4-) | inquire | >90% | 0 |
| 06388 |  | Cyclic(-NH-PEG3-) | 101,000/0.1mg | >90% | 0 |
It is also possible to synthesise branched azacrowns via amide bonds or alkyl groups. These have not yet been synthesised, but the derivation from azacrowns is straightforward and ready to use.
Click here 
for a list of crown ethers with branches without N.
Limited to what is technically possible, e.g. length of PEG chain, substitution to heteroatoms other than O, number of substitutions, etc., but feel free to ask anything!
Compound search：Set keywords and then click SEARCH.
Compound search：Check categories and click SEARCH button.
