リストに無い構造でもお気軽にお問い合わせください。リスト品と同等の価格、納期でご提供できるかもしれません。
お気軽にどうぞ。
category = @13
SCHEM No. | Structure | Compound Name | Price (JPY) | Purity | Stock(mg) |
---|---|---|---|---|---|
05950 | ![]() | Sulforhodamine bis(CO-PEG14-COOH) | 64,600/0.1mg | >95% | 1.6 |
06410 | ![]() | Cy7(PEG13-COOH)(PEG3-OMe) | 119,600/0.1mg | >95% | 0.4 |
06401 | ![]() | TMSI(1-PEG13-OTrt) | 64,600/0.1mg | >95% | 0 |
06396 | ![]() | AADIS7-PEG13-COOH | 119,600/0.1mg | >95% | 0.3 |
06390 | ![]() | AADIS7-PEG13-COOtBu | 96,000/0.1mg | >95% | 0.9 |
06311 | ![]() | TMSI(1-PEG13-COOH) | 64,600/0.1mg | >95% | 11.1 |
06064 | ![]() | Cy7-NHPEG13-COOtBu | 96,000/0.1mg | >95% | 0 |
05373 | ![]() | Alexa 647-CONH-PEG13-CONH-PEG2-O-HexCl | 119,600/0.1mg | >95% | 0.1 |
05078 | ![]() | Alexa 647-NH-PEG13-COOtBu | 96,000/0.1mg | >95% | 0 |
04731 | ![]() | DY-547-CONH-PEG13-COOH | 69100/<0.1mg | >95% | 0.1 |
04730 | ![]() | Texas-Red-X-CONH-PEG13-COOH mixed isomers | 69100/<0.1mg | >95% | 0.1 |
06456 | ![]() | TMSI(1-PEG12-OMe) | 64,600/0.1mg | >80% | 9.0 |
06394 | ![]() | TMSI(1-PEG12-OH) | 119,600/0.1mg | >95% | 6.1 |
06363 | ![]() | SH-PEG12-SH | 70,300/2.5mg | >90% | 0 |
06354 | ![]() | Cyclic(-S-PEG12-S-) | inquire | >95% | 0 |
06338 | ![]() | SCSOEt-PEG12-SCSOEt | 64,600/0.5mg | >90% | 0 |
06362 | ![]() | SH-PEG11-SH | 67,300/0.2mg | >90% | 0 |
06361 | ![]() | SH-PEG10-SH | 67,300/0.5mg | >90% | 0 |
06356 | ![]() | Cyclic(-S-PEG10-) | inquire | >95% | 0 |
06355 | ![]() | Cyclic(-S-PEG4-S-PEG6-) | inquire | >95% | 0 |
06069 | ![]() | TMSI(1-PEG10-OH) | 64,600/0.1mg | >95% | 0.1 |
06375 | ![]() | Cyclic(-S-PEG9-) | 80,700/0.1mg | >95% | 3.5 |
06068 | ![]() | TMSI(1-PEG10-OTrt) | 64,600/0.3mg | >95% | 9.0 |
01749 | ![]() | SCSOEt-PEG9-SCSOEt | 67,600/2.5mg | >95% | 0 |
01724 | ![]() | SH-PEG9-SH | 70,300/2.5mg | >90% | 44.3 |
06360 | ![]() | SH-PEG8-SH | 83,700/2.5mg | >90% | 0 |
06349 | ![]() | Cyclic(-S-PEG5-S-PEG3-) | inquire | >95% | 0 |
06295 | ![]() | TMSI(1-PEG8-OH) | 63,300/0.9mg | >95% | 12.8 |
00369 | ![]() | N3-PEG8-COOH | 73,600/2.5mg | >95% | 0 |
06398 | ![]() | TMSI(1-PEG7-OH) | 63,300/0.9mg | >95% | 1.3 |
06359 | ![]() | SH-PEG7-SH | 79,400/0.9mg | >90% | 0 |
06350 | ![]() | Cyclic(-S-PEG7-S-PEG1-) | inquire | >95% | 0 |
06397 | ![]() | TMSI(1-PEG6-OH) | 63,300/0.9mg | >95% | 1.2 |
01794 | ![]() | SH-PEG6-SH | 63,300/0.9mg | >90% | 0 |
06453 | ![]() | SCNHNH2-PEG5-SCNHNH2 | 74,700/50mg | >95% | 335.0 |
06377 | ![]() | Cyclic(-S-PEG5-) | inquire | >95% | 0 |
06357 | ![]() | SH-PEG5-SH | 63,300/0.9mg | >90% | 0 |
06294 | ![]() | TMSI(1-PEG5-NHTrt) | 64,600/0.1mg | >95% | 2.6 |
05343 | ![]() | DMT-PEG5-S-PEG4-ODMT | 64,600/500mg | >80% | 2,114.2 |
04857 | ![]() | Sulforhodamine bis(piperazine-PEG5-COOH) | 64,600/0.5mg | >95% | 7.0 |
04743 | ![]() | DMT-PEG5-S-Et-OH | 72,000/50mg | >90% | 300.6 |
06473 | ![]() | TMSI(2-PEG4-COOH) | 63,300/0.9mg | >95% | 11.8 |
06405 | ![]() | N3-PEG4-AADIS7 | 64,600/0.1mg | >95% | 2.5 |
06387 | ![]() | SCSOEt-PEG4-SCSOEt | 72,000/50mg | >90% | 669.7 |
06384 | ![]() | Cyclic(-S-PEG4-S-)9 | 135,700/0.1mg | >95% | 0.1 |
06383 | ![]() | Cyclic(-S-PEG4-S-)8 | 135,700/0.1mg | >90% | 0.1 |
06382 | ![]() | Cyclic(-S-PEG4-S-)7 | 135,700/0.1mg | >90% | 0.1 |
06381 | ![]() | Cyclic(-S-PEG4-S-)6 | 135,700/0.1mg | >90% | 0.1 |
06380 | ![]() | Cyclic(-S-PEG4-S-)5 | 135,700/0.1mg | >90% | 0.1 |
06379 | ![]() | Cyclic(-S-PEG4-S-)4 | 135,700/0.1mg | >90% | 0.1 |
06378 | ![]() | Cyclic(-S-PEG4-S-)3 | 135,700/0.1mg | >90% | 0.1 |
06353 | ![]() | Cyclic(-S-PEG4-S-)4 | 77,800/0.1mg | >95% | 0 |
06352 | ![]() | Cyclic(-S-PEG4-S-)3 | 77,800/0.1mg | >95% | 0 |
06348 | ![]() | Cyclic(-S-PEG4-)2 | inquire | >95% | 0 |
06343 | ![]() | Cyclic(-S-PEG4-S-)2 | 135,700/0.1mg | >95% | 0.1 |
06340 | ![]() | SH-PEG4-SS-PEG4-SH | 83,400/0.9mg | >90% | 34.0 |
06062 | ![]() | Cy7-PEG4-COOH | 96,000/0.1mg | >95% | 0.1 |
06059 | ![]() | AADIS7-PEG4-COOMe | 119,600/0.1mg | >95% | 3.9 |
06009 | ![]() | Cy7 PEG4-COOMe | 96,000/0.1mg | >95% | 0 |
05948 | ![]() | TMSI(1-PEG4-OH) | 64,600/0.2mg | >95% | 15.7 |
05344 | ![]() | DMT-PEG4-S-Et-OAc | 64,600/100mg | >80% | 426.3 |
05075 | ![]() | Ac-PEG3-AADIS7 | 64,600/0.5mg | >95% | 3.0 |
04712 | ![]() | SH-PEG4-SH | 87,400/5mg | >90% | 60.0 |
04674 | ![]() | SCNHNH2-PEG4-SCNHNH2 | 74,700/50mg | >95% | 1,350.9 |
04673 | ![]() | Tos-PEG4-SCNHNH2 | 64,600/75mg | >95% | 776.1 |
03828 | ![]() | Trt-PEG3-S-Et-OH | 74,600/25mg | >90% | 408.1 |
03545 | ![]() | TMSI(1-PEG4-COOMe) | 64,600/0.1mg | >95% | 1.6 |
02292 | ![]() | DMT-PEG4-SS-PEG4-OTos | 67,700/5mg | >95% | 30.8 |
02196 | ![]() | Trt-PEG4-SH | 64,000/0.2mg | >95% | 1.8 |
02194 | ![]() | DMT-PEG4-SS-Et-OH | 65,600/25mg | >95% | 371.1 |
02193 | ![]() | Trt-PEG4-SS-Et-OTos | 67,700/5mg | >95% | 0 |
01266 | ![]() | Trt-PEG4-SS-PEG4-N3 | 66,300/2.5mg | >90% | 0 |
06450 | ![]() | (OH-PEG3-S-)2 | 79,400/0.9mg | >95% | 7.2 |
06393 | ![]() | TMSI(1-PEG3-OMe) | 63,300/0.9mg | >95% | 11.6 |
06358 | ![]() | SH-PEG3-SH | 96,800/0.1mg | >90% | 1.3 |
06351 | ![]() | Cyclic(-S-PEG3-S-PEG1-)2 | inquire | >95% | 0 |
06346 | ![]() | Cyclic(-S-PEG3-S-CH2-O-CH2-)2 | inquire | >95% | 0 |
06342 | ![]() | Cyclic(-S-PEG3-S-)2 | inquire | >95% | 0 |
06341 | ![]() | SH-PEG3-SS-PEG3-SH | 83,400/0.9mg | >90% | 0 |
06061 | ![]() | 6-[(2E)-2-[(2E,4E,6E)-7-[1-[2-(2-acetoxyethoxy)ethyl]-3,3-dimethyl-5-sulfo-indol-2-yl]hepta-2,4,6-trienylidene]-3,3-dimethyl-indolin-1-yl]hexanoic acid | 96,000/0.1mg | >95% | 0.1 |
05146 | ![]() | TMSI(1-PEG3-OH) | 64,600/0.1mg | >95% | 27.0 |
03842 | ![]() | N3-PEG3-O-Et-SS-Et-PEG3-OH | 70,400/5mg | >95% | 38.9 |
03032 | ![]() | DMT-PEG3-NH-Et-SS-Et-NH2 | 66,300/2.5mg | >95% | 37.9 |
02345 | ![]() | TrtNH-PEG3-NHCO-Et-S-COMe | 65,200/7.5mg | >95% | 98.0 |
02065 | ![]() | Trt-PEG3-SSO3H | 63,100/0.6mg | >95% | 26.8 |
01905 | ![]() | N3-PEG3-SCSOEt | 65,700/0.6mg | >95% | 77.4 |
01636 | ![]() | SO3H-PEG3-OH | 65,700/0.6mg | <80% | 60.0 |
01331 | ![]() | Cy5-NH-PEG3-NH2 | 63,300/0.9mg | >95% | 0 |
02195 | ![]() | TrtNH-PEG1-S-Et-OH | 65,600/25mg | >90% | 136.0 |
04961 | ![]() | 2-(2-trityloxyethyldisulfanyl)ethanol | 64,600/100mg | >95% | 178.4 |
01699 | ![]() | SCSOEt-PEG2K-SCSOEt | 72,000/5mg | out of warranty | 353.0 |
06523 | ![]() | 1-[2-(carboxymethoxy)ethyl]-2-[(1E,3E,5E,7E)-7-[1-[2-(carboxymethoxy)ethyl]-3,3-dimethyl-5-sulfo-indolin-2-ylidene]-4-(2-sulfoethyl)hepta-1,3,5-trienyl]-3,3-dimethyl-indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06522 | ![]() | (3S)-1-(5-carboxypentyl)-2-[(1E,3E,5E,7E)-7-[(3R)-1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-3-methyl-5-sulfo-3-(3-sulfopropyl)indolin-2-ylidene]hepta-1,3,5-trienyl]-3-methyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06521 | ![]() | 1-(5-carboxypentyl)-2-[(E,3E)-3-[1-[2-(2-methoxyethoxy)ethyl]-3-methyl-5-sulfo-3-(3-sulfopropyl)indolin-2-ylidene]prop-1-enyl]-3-methyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06520 | ![]() | 2-[(1E,3E,5Z)-5-[1,3-bis[2-(2-methoxyethoxy)ethyl]-3-methyl-5-sulfo-indolin-2-ylidene]penta-1,3-dienyl]-1-[2-[2-(2-carboxyethoxy)ethoxy]ethyl]-3-[2-(2-methoxyethoxy)ethyl]-3-methyl-indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06519 | ![]() | 1-(5-carboxypentyl)-2-[(1E,3E,5E,7E)-7-[1-ethyl-3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-3-methyl-5-sulfo-indolin-2-ylidene]hepta-1,3,5-trienyl]-3-[2-(2-methoxyethoxy)ethyl]-3-methyl-indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06518 | ![]() | 2-[(1E,3E,5Z)-5-[1-(5-carboxypentyl)-3,3-dimethyl-5-sulfo-indolin-2-ylidene]penta-1,3-dienyl]-1-ethyl-3-[2-(2-methoxyethoxy)ethyl]-3-methyl-indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06517 | ![]() | 1-(4-aminobutyl)-2-[(1E,3E,5E)-5-[1-(5-carboxypentyl)-3,3-dimethyl-indolin-2-ylidene]penta-1,3-dienyl]-3,3-dimethyl-indol-1-ium-5-sulfonate | 119,600/0.1mg | >95% | 0 |
06516 | ![]() | (3R)-2-[(1E,3E,5E)-5-[(3S)-1-(5-carboxypentyl)-3-methyl-5-sulfo-3-(3-sulfopropyl)indolin-2-ylidene]penta-1,3-dienyl]-1-[2-(2-methoxyethoxy)ethyl]-3-methyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06515 | ![]() | 2-[(E,3E)-3-[3,3-dimethyl-5-sulfo-1-[2-[2-(4-sulfobutoxy)ethoxy]ethyl]indolin-2-ylidene]prop-1-enyl]-3,3-dimethyl-1-[2-[2-(4-sulfobutoxy)ethoxy]ethyl]indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06514 | ![]() | 1-ethyl-2-[(E,3E)-3-[1-[6-(2-hydroxyethoxy)-6-oxo-hexyl]-3,3-dimethyl-5-sulfo-indolin-2-ylidene]prop-1-enyl]-3,3-dimethyl-indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06513 | ![]() | 3-[2-[(1E,3E,5Z)-5-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indolin-2-ylidene]penta-1,3-dienyl]-3-[5-[2-(2-hydroxyethoxy)ethylamino]-5-oxo-pentyl]-3-methyl-5-sulfo-indol-1-ium-1-yl]propane-1-sulfonate | inquire | >95% | 0 |
06512 | ![]() | 3-(5-carboxypentyl)-1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-2-[(1E,3E,5E)-5-[3-(2-methoxyethyl)-1-methyl-1-(3-sulfopropyl)benzo[e]indol-2-ylidene]penta-1,3-dienyl]-1-methyl-8-sulfo-benzo[e]indol-3-ium-6-sulfonate | inquire | >95% | 0 |
06511 | ![]() | 3-(5-carboxypentyl)-1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-2-[(1E,3E,5E)-5-[3-(2-methoxyethyl)-1-methyl-1-(3-sulfopropyl)benzo[e]indol-2-ylidene]penta-1,3-dienyl]-1-methyl-8-sulfo-benzo[e]indol-3-ium-6-sulfonate | inquire | >95% | 0 |
06510 | ![]() | 3-[2-[(1E,3E,5E,7Z)-7-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indolin-2-ylidene]hepta-1,3,5-trienyl]-3-[6-[2-(2-methoxyethoxy)ethylamino]-6-oxo-hexyl]-3-methyl-5-sulfo-indol-1-ium-1-yl]propane-1-sulfonate | inquire | >95% | 0 |
06509 | ![]() | 1-(5-carboxypentyl)-2-[(E,3Z)-3-[1-ethyl-3-[2-(2-methoxyethoxy)ethyl]-3-methyl-5-sulfo-indolin-2-ylidene]prop-1-enyl]-3-[2-(2-methoxyethoxy)ethyl]-3-methyl-indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06490 | ![]() | 3',6'-bis(3-sulfanylpropoxy)spiro[isobenzofuran-3,9'-xanthene]-1-one | 119,600/0.1mg | >95% | 0 |
06446 | ![]() | 3-[2-[2-[(2E)-2-[(E)-3-[3,3-dimethyl-1-[2-[2-(3-sulfopropoxy)ethoxy]ethyl]indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-indolin-1-yl]ethoxy]ethoxy]propane-1-sulfonic acid | inquire | >95% | 0 |
06442 | ![]() | [3-oxo-6'-(3-sulfanylpropanoyloxy)spiro[isobenzofuran-1,9'-xanthene]-3'-yl] 3-sulfanylpropanoate | 119,600/0.1mg | >95% | 0 |
06440 | ![]() | (3R)-1-(5-carboxypentyl)-2-[(1E,3E,5E,7E)-7-[(3R)-1-[2-(2-methoxyethoxy)ethyl]-3-methyl-5-sulfo-3-(3-sulfopropyl)indolin-2-ylidene]hepta-1,3,5-trienyl]-3-methyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06439 | ![]() | 1-(5-carboxypentyl)-2-[(1E,3E,5Z)-5-[1-[2-(2-methoxyethoxy)ethyl]-3-methyl-5-sulfo-3-(3-sulfopropyl)indolin-2-ylidene]penta-1,3-dienyl]-3-methyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06434 | ![]() | 2-[(E,3Z)-3-[1,3-bis[2-(2-methoxyethoxy)ethyl]-3-methyl-5-sulfo-indolin-2-ylidene]prop-1-enyl]-1-[2-[2-(2-carboxyethoxy)ethoxy]ethyl]-3-[2-(2-methoxyethoxy)ethyl]-3-methyl-indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06433 | ![]() | 1-(5-carboxypentyl)-2-[(1E,3E,5E)-5-[1-ethyl-3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-3-methyl-5-sulfo-indolin-2-ylidene]penta-1,3-dienyl]-3-[2-(2-methoxyethoxy)ethyl]-3-methyl-indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06432 | ![]() | 1-(5-carboxypentyl)-2-[(E,3E)-3-[1-[2-(2-methoxyethoxy)ethyl]-3-methyl-5-sulfo-3-(3-sulfopropyl)indolin-2-ylidene]prop-1-enyl]-3-methyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06431 | ![]() | 2-[(1E,3E,5E,7E)-7-[1-(5-carboxypentyl)-3-methyl-5-sulfo-3-(3-sulfopropyl)indolin-2-ylidene]hepta-1,3,5-trienyl]-1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-3-methyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06430 | ![]() | 2-[(1E,3E,5E)-5-[1-(5-carboxypentyl)-3-methyl-5-sulfo-3-(3-sulfopropyl)indolin-2-ylidene]penta-1,3-dienyl]-1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-3-methyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06428 | ![]() | 2-[(1E,3E,5Z)-5-[1-(5-carboxypentyl)-3-methyl-5-sulfo-3-(3-sulfopropyl)indolin-2-ylidene]penta-1,3-dienyl]-1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-3-methyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06427 | ![]() | (3R)-2-[(1E,3E,5E)-5-[(3R)-1-(5-carboxypentyl)-3-methyl-5-sulfo-3-(3-sulfopropyl)indolin-2-ylidene]penta-1,3-dienyl]-1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-3-methyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06426 | ![]() | (3S)-1-(5-carboxypentyl)-2-[(1E,3E,5E,7E)-7-[(3R)-1-[2-(2-methoxyethoxy)ethyl]-3-methyl-5-sulfo-3-(3-sulfopropyl)indolin-2-ylidene]hepta-1,3,5-trienyl]-3-methyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06425 | ![]() | 2-[(1Z,3E,5E,7E)-7-[1-(5-carboxypentyl)-3-methyl-5-sulfo-3-(3-sulfopropyl)indolin-2-ylidene]hepta-1,3,5-trienyl]-1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-3-methyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06423 | ![]() | 2-[(1E,3E,5E,7E)-7-[1-(5-carboxypentyl)-3-methyl-5-sulfo-3-(3-sulfopropyl)indolin-2-ylidene]hepta-1,3,5-trienyl]-1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-3-methyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06422 | ![]() | (3R)-2-[(1E,3E,5E)-5-[(3S)-1-(5-carboxypentyl)-3-methyl-5-sulfo-3-(3-sulfopropyl)indolin-2-ylidene]penta-1,3-dienyl]-1-[2-(2-methoxyethoxy)ethyl]-3-methyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06421 | ![]() | 1-(5-carboxypentyl)-2-[(E,3E)-3-[1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-3-methyl-5-sulfo-3-(3-sulfopropyl)indolin-2-ylidene]prop-1-enyl]-3-methyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06420 | ![]() | (3R)-1-(5-carboxypentyl)-2-[(E,3E)-3-[(3S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-3-methyl-5-sulfo-3-(3-sulfopropyl)indolin-2-ylidene]prop-1-enyl]-3-methyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06419 | ![]() | (3R)-2-[(1E,3E,5E)-5-[(3S)-1-(5-carboxypentyl)-3-methyl-5-sulfo-3-(3-sulfopropyl)indolin-2-ylidene]penta-1,3-dienyl]-1-[2-(2-methoxyethoxy)ethyl]-3-methyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06418 | ![]() | 3-[2-[2-[2-[(1E,3E,5E,7Z)-7-[1,3-bis[2-(2-methoxyethoxy)ethyl]-3-methyl-5-sulfo-indolin-2-ylidene]hepta-1,3,5-trienyl]-3-[2-(2-methoxyethoxy)ethyl]-3-methyl-5-sulfo-indol-1-ium-1-yl]ethoxy]ethoxy]propanoic acid | inquire | >95% | 0 |
06417 | ![]() | (3S)-1-(5-carboxypentyl)-2-[(1E,3E,5E,7E)-7-[(3R)-1-[2-(2-methoxyethoxy)ethyl]-3-methyl-5-sulfo-3-(3-sulfopropyl)indolin-2-ylidene]hepta-1,3,5-trienyl]-3-methyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06416 | ![]() | 1-(5-carboxypentyl)-2-[(E,3E)-3-[1-[2-(2-methoxyethoxy)ethyl]-3-methyl-5-sulfo-3-(3-sulfopropyl)indolin-2-ylidene]prop-1-enyl]-3-methyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonate | inquire | >95% | 0 |
06297 | ![]() | AcOEt-AADIS5 | 64,600/0.2mg | >95% | 8.0 |
06296 | ![]() | Cy5(COOH)(SO3H) | 96,000/0.1mg | >95% | 0.9 |
06167 | ![]() | 1-phenyl-5-propylsulfonyl-tetrazole | 64,600/50mg | >95% | 617.8 |
06162 | ![]() | 5-butylsulfonyl-1-phenyl-tetrazole | 64,600/50mg | >95% | 1,246.2 |
06145 | ![]() | 5-ethylsulfanyl-1-phenyl-tetrazole | 64,600/50mg | >95% | 300.0 |
06114 | ![]() | AADIS7-ESO3H | 64,600/0.1mg | >80% | 7.6 |
06035 | ![]() | TMSI(1-Et-SO3H) | 64,600/0.5mg | >80% | 20.4 |
05969 | ![]() | ADIS5-HexCOOH | 64,600/0.1mg | >95% | 1.0 |
05968 | ![]() | 2-[4-[6'-[4-(carboxymethyl)piperazin-1-yl]-1,1-dioxo-spiro[2,1-ramda-benzoxathiole-3,9'-xanthene]-3'-yl]piperazin-1-yl]acetic acid | 64,600/0.1mg | >95% | 1.0 |
05967 | ![]() | 2-[4-(1,1-dioxo-6'-piperazin-1-yl-spiro[2,1-ramda--benzoxathiole-3,9'-xanthene]-3'-yl)piperazin-1-yl]acetic acid | 64,600/0.1mg | >95% | 0 |
05959 | ![]() | AADIS5-Me | 64,600/0.2mg | >95% | 9.3 |
05955 | ![]() | Cy7-bis COOH | 64,600/0.2mg | >90% | 0.1 |
05954 | ![]() | AADIS7-HexCOOH | 64,600/0.1mg | >95% | 0.1 |
05945 | ![]() | TMSI(1-acetoxyacetic acid) | 64,600/0.1mg | >95% | 5.3 |
05944 | ![]() | TMSI(1-Me) | 64,600/0.1mg | >95% | 3.3 |
05941 | ![]() | AADIS5-HexCOOH | 63,300/0.9mg | >95% | 31.2 |
05940 | ![]() | Cy5 dicarboxylic acid | 63,300/0.9mg | >95% | 0.5 |
05923 | ![]() | (Boc-Cys-OBn)2 | 67,600/25mg | >95% | 1.3 |
05393 | ![]() | Cy7-mono COOH | 64,600/0.1mg | >95% | 0.1 |
05374 | ![]() | 2-[[(1S,2R)-1-(fluoromethyl)-2-hydroxy-2-(4-methylsulfonylphenyl)ethyl]amino]-2-oxo-acetic acid | 65,200/7.5mg | >95% | 73.3 |
05372 | ![]() | N-[(1S,2R)-1-(fluoromethyl)-2-hydroxy-2-(4-methylsulfonylphenyl)ethyl]-2-hydroxy-acetamide | 65,600/25mg | >95% | 82.4 |
05371 | ![]() | Tos-O-Et-SS-Et-OTos | 72,000/50mg | >95% | 291.6 |
05364 | ![]() | AADIS5-Et-SO3H | 96,000/0.1mg | >95% | 2.4 |
05342 | ![]() | Sodium 4-dodecylbenzenesulfonate | inquire | >95% | 30.0 |
05314 | ![]() | p-n-Dodecylbenzenesulfonic Acid Sodium Salt 13C6 | inquire | >95% | 5.8 |
05148 | ![]() | Sulfo-Cy3 bis(IAA) | 64,600/0.2mg | >95% | 0.1 |
05147 | ![]() | Sulfo Cy3-diamine | 64,600/0.2mg | >95% | 5.0 |
05143 | ![]() | Sulfo-Cy3 | 64,600/0.5mg | >95% | 2.6 |
05142 | ![]() | TMSI(1-Et-OH) | 72,000/5mg | >95% | 325.6 |
05141 | ![]() | TMSI(1-acetic acid) | 64,600/0.3mg | >95% | 13.3 |
05130 | ![]() | Suflo-Cy3 | 63,300/0.9mg | >95% | 4.7 |
05072 | ![]() | AADIS7-Me | 64,600/0.3mg | >95% | 1.7 |
05048 | ![]() | Bentazone-D7 | 88,000/20mg | >95% | 0 |
05047 | ![]() | Isoprothiolane-D4 | 55,000/20mg | >95% | 0 |
05033 | ![]() | Ampicillin-D5 | 77,000/10mg | >95% | 0 |
04939 | ![]() | Mono-6-SH-gamma-cyclodextrin | 67,900/7.5mg | >90% | 170.0 |
04938 | ![]() | Mono-6-SH-alpha-cyclodextrin | 65,200/7.5mg | >90% | 161.0 |
04925 | ![]() | Thiuram-D12 | inquire | >95% | 160.0 |
04891 | ![]() | 2-S-Cysteinyldopa | 81,600/0.1mg | >95% | 25.0 |
04876 | ![]() | Mono-6-SH-beta-cyclodextrin | 65,200/7.5mg | >90% | 112.0 |
04852 | ![]() | bis-(IAA-piperazinyl) sulforhodamine | 64,600/0.3mg | >95% | 0.9 |
04282 | ![]() | Mono TSE succinic acid | 64,600/75mg | >95% | 1,400.0 |
04148 | ![]() | 3-[(7-aminophenothiazin-5-ium-3-yl)-(3-sulfopropyl)amino]propane-1-sulfonate(mix isomers) | 64,600/0.1mg | >95% | 3.8 |
04136 | ![]() | TMSI(1-Hex-COOH) | 63,300/0.9mg | >95% | 754.0 |
04084 | ![]() | Ethanesulfonic acid, 2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]- | 64,600/10mg | >95% | 400.0 |
04080 | ![]() | Ethanesulfonic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]- | 65,600/25mg | >95% | 300.0 |
03666 | ![]() | 1-amino-4-(dimethylamino)-2-sulfosulfanyl-benzene | 66,400/500mg | >95% | 5,749.6 |
03607 | ![]() | TMSI-K salt | 64,600/5mg | >90% | 6,603.9 |
02909 | ![]() | GSH-S-Bimane | 64,600/10mg | >95% | 30.3 |
02363 | ![]() | S-tritylmercaptopropionic acid | 64,600/75mg | >95% | 1,000.0 |
02358 | ![]() | rac-(2S)-4-tert-butoxy-2-[[4-tert-butoxy-4-oxo-2-[6-[[rac-(2S)-5-acetylsulfanyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoyl]amino]hexanoylamino]butanoyl]amino]-4-oxo-butanoic acid | 64,600/0.1mg | >95% | 6.0 |
02331 | ![]() | Acetylmercaptopropionic acid | 67,600/7.5mg | >95% | 856.0 |
01980 | ![]() | Cy3-halolinker | 64,600/0.3mg | >95% | 0.1 |
01516 | ![]() | Arsenosugar monosulfate | 200,000/<0.1mg | >95% | 0.2 |
00656 | ![]() | N-[2-(2-aminoethyldisulfanyl)ethyl]-4-[3-(trifluoromethyl)diazirin-3-yl]benzamide | 65,600/25mg | >95% | 806.0 |
00651 | ![]() | 4-Amino-N-(5-methyl-isoxazol-3-yl)-benzenesulfonamide-d4 | 68,000/10mg | >95% | 817.0 |
00583 | ![]() | C10-SPC | 75,000/10mg | >95% | 15.0 |
00582 | ![]() | C8-SPC | 96,000/0.1mg | >95% | 105.0 |
00413 | ![]() | 1H-Imidazolium, 1,2-dimethyl-3-[(2,2,2-trichloroethoxy)sulfonyl]-, 1,1,1-trifluoromethanesulfonate | 65,600/25mg | >95% | 466.0 |
00352 | ![]() | 2,2,2-Trichloroethyl chlorosulfate | 64,600/10mg | out of warranty | 2,521.7 |